C19H20INO4 — CID 134015908
propan-2-yl 3-[[(E)-3-(5-iodofuran-2-yl)prop-2-enoyl]amino]-3-phenylpropanoate (PubChem CID 134015908) has the molecular formula C19H20INO4 and a molecular weight of 453.28 g/mol. Its IUPAC name is propan-2-yl 3-[[(E)-3-(5-iodofuran-2-yl)prop-2-enoyl]amino]-3-phenylpropanoate.
| Compound Name | propan-2-yl 3-[[(E)-3-(5-iodofuran-2-yl)prop-2-enoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 134015908 |
| Molecular Formula | C19H20INO4 |
| Molecular Weight | 453.28 g/mol |
| Exact Mass | 453.04 |
| IUPAC Name | propan-2-yl 3-[[(E)-3-(5-iodofuran-2-yl)prop-2-enoyl]amino]-3-phenylpropanoate |
| SMILES | CC(C)OC(=O)CC(NC(=O)/C=C/c1ccc(I)o1)c1ccccc1 |
| InChI | InChI=1S/C19H20INO4/c1-13(2)24-19(23)12-16(14-6-4-3-5-7-14)21-18(22)11-9-15-8-10-17(20)25-15/h3-11,13,16H,12H2,1-2H3,(H,21,22)/b11-9+ |
| InChIKey | DRBGPNWHIMQPOL-PKNBQFBNSA-N |
| XLogP | 4.10 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.28 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|