C20H26N2O2S — CID 7072055
N-[[(1S)-1-(1-adamantyl)ethyl]carbamothioyl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 7072055) has the molecular formula C20H26N2O2S and a molecular weight of 358.51 g/mol. Its IUPAC name is N-[[(1S)-1-(1-adamantyl)ethyl]carbamothioyl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | N-[[(1S)-1-(1-adamantyl)ethyl]carbamothioyl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 7072055 |
| Molecular Formula | C20H26N2O2S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | N-[[(1S)-1-(1-adamantyl)ethyl]carbamothioyl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | C[C@H](NC(=S)NC(=O)C=Cc1ccco1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H26N2O2S/c1-13(20-10-14-7-15(11-20)9-16(8-14)12-20)21-19(25)22-18(23)5-4-17-3-2-6-24-17/h2-6,13-16H,7-12H2,1H3,(H2,21,22,23,25)/t13-,14?,15?,16?,20?/m0/s1 |
| InChIKey | HOFQZXZLKURLNP-IVKJLDKCSA-N |
| XLogP | 3.89 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|