C23H25NO2 — CID 7921396
(E)-N-[4-(1-adamantyl)phenyl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 7921396) has the molecular formula C23H25NO2 and a molecular weight of 347.46 g/mol. Its IUPAC name is (E)-N-[4-(1-adamantyl)phenyl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[4-(1-adamantyl)phenyl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 7921396 |
| Molecular Formula | C23H25NO2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | (E)-N-[4-(1-adamantyl)phenyl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccco1)Nc1ccc(C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C23H25NO2/c25-22(8-7-21-2-1-9-26-21)24-20-5-3-19(4-6-20)23-13-16-10-17(14-23)12-18(11-16)15-23/h1-9,16-18H,10-15H2,(H,24,25)/b8-7+ |
| InChIKey | RNZYHRQIHAMPFS-BQYQJAHWSA-N |
| XLogP | 5.40 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|