C18H19FN4OS — CID 19342457
1-[1-[(4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(furan-2-ylmethyl)thiourea (PubChem CID 19342457) has the molecular formula C18H19FN4OS and a molecular weight of 358.44 g/mol. Its IUPAC name is 1-[1-[(4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-[1-[(4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 19342457 |
| Molecular Formula | C18H19FN4OS |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 1-[1-[(4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(furan-2-ylmethyl)thiourea |
| SMILES | Cc1nn(Cc2ccc(F)cc2)c(C)c1NC(=S)NCc1ccco1 |
| InChI | InChI=1S/C18H19FN4OS/c1-12-17(21-18(25)20-10-16-4-3-9-24-16)13(2)23(22-12)11-14-5-7-15(19)8-6-14/h3-9H,10-11H2,1-2H3,(H2,20,21,25) |
| InChIKey | BXUNRKUTGRWURV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 55.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|