C19H30IN7O3S — CID 110034164
2-[[N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-N'-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110034164) has the molecular formula C19H30IN7O3S and a molecular weight of 563.47 g/mol. Its IUPAC name is 2-[[N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-N'-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-N'-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110034164 |
| Molecular Formula | C19H30IN7O3S |
| Molecular Weight | 563.47 g/mol |
| Exact Mass | 563.12 |
| IUPAC Name | 2-[[N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-N'-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCc1nn(C)cc1CN/C(=N/Cc1ccc(S(N)(=O)=O)cc1)NCC(=O)N(C)C.I |
| InChI | InChI=1S/C19H29N7O3S.HI/c1-5-17-15(13-26(4)24-17)11-22-19(23-12-18(27)25(2)3)21-10-14-6-8-16(9-7-14)30(20,28)29;/h6-9,13H,5,10-12H2,1-4H3,(H2,20,28,29)(H2,21,22,23);1H |
| InChIKey | DLCFDJPXQTWSKO-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 134.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.47 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|