C19H32N4O2S — CID 111947471
1-(3-cyclohexylpropyl)-3-ethyl-2-[(4-sulfamoylphenyl)methyl]guanidine (PubChem CID 111947471) has the molecular formula C19H32N4O2S and a molecular weight of 380.56 g/mol. Its IUPAC name is 1-(3-cyclohexylpropyl)-3-ethyl-2-[(4-sulfamoylphenyl)methyl]guanidine.
| Compound Name | 1-(3-cyclohexylpropyl)-3-ethyl-2-[(4-sulfamoylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111947471 |
| Molecular Formula | C19H32N4O2S |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 1-(3-cyclohexylpropyl)-3-ethyl-2-[(4-sulfamoylphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(S(N)(=O)=O)cc1)NCCCC1CCCCC1 |
| InChI | InChI=1S/C19H32N4O2S/c1-2-21-19(22-14-6-9-16-7-4-3-5-8-16)23-15-17-10-12-18(13-11-17)26(20,24)25/h10-13,16H,2-9,14-15H2,1H3,(H2,20,24,25)(H2,21,22,23) |
| InChIKey | ULCJOYZWRQUAHY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|