C23H16N2O6 — CID 44604224
methyl 2-[(R)-(1,3-dioxobenzo[de]isoquinolin-2-yl)-(2-nitrophenyl)methyl]prop-2-enoate (PubChem CID 44604224) has the molecular formula C23H16N2O6 and a molecular weight of 416.39 g/mol. Its IUPAC name is methyl 2-[(R)-(1,3-dioxobenzo[de]isoquinolin-2-yl)-(2-nitrophenyl)methyl]prop-2-enoate.
| Compound Name | methyl 2-[(R)-(1,3-dioxobenzo[de]isoquinolin-2-yl)-(2-nitrophenyl)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 44604224 |
| Molecular Formula | C23H16N2O6 |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | methyl 2-[(R)-(1,3-dioxobenzo[de]isoquinolin-2-yl)-(2-nitrophenyl)methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H](c1ccccc1[N+](=O)[O-])N1C(=O)c2cccc3cccc(c23)C1=O |
| InChI | InChI=1S/C23H16N2O6/c1-13(23(28)31-2)20(15-9-3-4-12-18(15)25(29)30)24-21(26)16-10-5-7-14-8-6-11-17(19(14)16)22(24)27/h3-12,20H,1H2,2H3/t20-/m0/s1 |
| InChIKey | NEOOPNSBXWDUMJ-FQEVSTJZSA-N |
| XLogP | 3.81 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|