C9H8BrF3N2O — CID 66465126
6-bromo-N-(3,3,3-trifluoropropyl)pyridine-3-carboxamide (PubChem CID 66465126) has the molecular formula C9H8BrF3N2O and a molecular weight of 297.07 g/mol. Its IUPAC name is 6-bromo-N-(3,3,3-trifluoropropyl)pyridine-3-carboxamide.
| Compound Name | 6-bromo-N-(3,3,3-trifluoropropyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66465126 |
| Molecular Formula | C9H8BrF3N2O |
| Molecular Weight | 297.07 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | 6-bromo-N-(3,3,3-trifluoropropyl)pyridine-3-carboxamide |
| SMILES | O=C(NCCC(F)(F)F)c1ccc(Br)nc1 |
| InChI | InChI=1S/C9H8BrF3N2O/c10-7-2-1-6(5-15-7)8(16)14-4-3-9(11,12)13/h1-2,5H,3-4H2,(H,14,16) |
| InChIKey | GUNFZPCNWSVGEK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.07 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|