C14H15F3N2O — CID 115521811
4-(3-aminoprop-1-ynyl)-N-(4,4,4-trifluorobutyl)benzamide (PubChem CID 115521811) has the molecular formula C14H15F3N2O and a molecular weight of 284.28 g/mol. Its IUPAC name is 4-(3-aminoprop-1-ynyl)-N-(4,4,4-trifluorobutyl)benzamide.
| Compound Name | 4-(3-aminoprop-1-ynyl)-N-(4,4,4-trifluorobutyl)benzamide |
|---|---|
| PubChem CID | 115521811 |
| Molecular Formula | C14H15F3N2O |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 4-(3-aminoprop-1-ynyl)-N-(4,4,4-trifluorobutyl)benzamide |
| SMILES | NCC#Cc1ccc(C(=O)NCCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H15F3N2O/c15-14(16,17)8-2-10-19-13(20)12-6-4-11(5-7-12)3-1-9-18/h4-7H,2,8-10,18H2,(H,19,20) |
| InChIKey | GLWPMQQDZTUWOR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|