C9H12F3N3O — CID 115491628
N-(5,5,5-trifluoropentyl)-1H-pyrazole-4-carboxamide (PubChem CID 115491628) has the molecular formula C9H12F3N3O and a molecular weight of 235.21 g/mol. Its IUPAC name is N-(5,5,5-trifluoropentyl)-1H-pyrazole-4-carboxamide.
| Compound Name | N-(5,5,5-trifluoropentyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 115491628 |
| Molecular Formula | C9H12F3N3O |
| Molecular Weight | 235.21 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | N-(5,5,5-trifluoropentyl)-1H-pyrazole-4-carboxamide |
| SMILES | O=C(NCCCCC(F)(F)F)c1cn[nH]c1 |
| InChI | InChI=1S/C9H12F3N3O/c10-9(11,12)3-1-2-4-13-8(16)7-5-14-15-6-7/h5-6H,1-4H2,(H,13,16)(H,14,15) |
| InChIKey | MQJYKUKTVJJILF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.21 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|