C13H18F3N3O — CID 115492102
2-(ethylamino)-N-(5,5,5-trifluoropentyl)pyridine-4-carboxamide (PubChem CID 115492102) has the molecular formula C13H18F3N3O and a molecular weight of 289.30 g/mol. Its IUPAC name is 2-(ethylamino)-N-(5,5,5-trifluoropentyl)pyridine-4-carboxamide.
| Compound Name | 2-(ethylamino)-N-(5,5,5-trifluoropentyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 115492102 |
| Molecular Formula | C13H18F3N3O |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 2-(ethylamino)-N-(5,5,5-trifluoropentyl)pyridine-4-carboxamide |
| SMILES | CCNc1cc(C(=O)NCCCCC(F)(F)F)ccn1 |
| InChI | InChI=1S/C13H18F3N3O/c1-2-17-11-9-10(5-8-18-11)12(20)19-7-4-3-6-13(14,15)16/h5,8-9H,2-4,6-7H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | NPHKJYMTUBWHRU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|