C10H10BrClN2O4 — CID 114037234
(2S,3R)-2-[(5-bromo-2-chloropyridine-3-carbonyl)amino]-3-hydroxybutanoic acid (PubChem CID 114037234) has the molecular formula C10H10BrClN2O4 and a molecular weight of 337.56 g/mol. Its IUPAC name is (2S,3R)-2-[(5-bromo-2-chloropyridine-3-carbonyl)amino]-3-hydroxybutanoic acid.
| Compound Name | (2S,3R)-2-[(5-bromo-2-chloropyridine-3-carbonyl)amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 114037234 |
| Molecular Formula | C10H10BrClN2O4 |
| Molecular Weight | 337.56 g/mol |
| Exact Mass | 335.95 |
| IUPAC Name | (2S,3R)-2-[(5-bromo-2-chloropyridine-3-carbonyl)amino]-3-hydroxybutanoic acid |
| SMILES | C[C@@H](O)[C@H](NC(=O)c1cc(Br)cnc1Cl)C(=O)O |
| InChI | InChI=1S/C10H10BrClN2O4/c1-4(15)7(10(17)18)14-9(16)6-2-5(11)3-13-8(6)12/h2-4,7,15H,1H3,(H,14,16)(H,17,18)/t4-,7+/m1/s1 |
| InChIKey | CNEOWGXPOMIPRK-FBCQKBJTSA-N |
| XLogP | 1.06 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.56 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|