C14H10BrClF2N2O — CID 62000639
5-bromo-2-chloro-N-[1-(2,5-difluorophenyl)ethyl]pyridine-3-carboxamide (PubChem CID 62000639) has the molecular formula C14H10BrClF2N2O and a molecular weight of 375.60 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[1-(2,5-difluorophenyl)ethyl]pyridine-3-carboxamide.
| Compound Name | 5-bromo-2-chloro-N-[1-(2,5-difluorophenyl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 62000639 |
| Molecular Formula | C14H10BrClF2N2O |
| Molecular Weight | 375.60 g/mol |
| Exact Mass | 373.96 |
| IUPAC Name | 5-bromo-2-chloro-N-[1-(2,5-difluorophenyl)ethyl]pyridine-3-carboxamide |
| SMILES | CC(NC(=O)c1cc(Br)cnc1Cl)c1cc(F)ccc1F |
| InChI | InChI=1S/C14H10BrClF2N2O/c1-7(10-5-9(17)2-3-12(10)18)20-14(21)11-4-8(15)6-19-13(11)16/h2-7H,1H3,(H,20,21) |
| InChIKey | FZLFIUGYSKVFNA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.60 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|