C16H14BrF2NO — CID 104852163
3-bromo-N-[1-(2,5-difluorophenyl)ethyl]-5-methylbenzamide (PubChem CID 104852163) has the molecular formula C16H14BrF2NO and a molecular weight of 354.19 g/mol. Its IUPAC name is 3-bromo-N-[1-(2,5-difluorophenyl)ethyl]-5-methylbenzamide.
| Compound Name | 3-bromo-N-[1-(2,5-difluorophenyl)ethyl]-5-methylbenzamide |
|---|---|
| PubChem CID | 104852163 |
| Molecular Formula | C16H14BrF2NO |
| Molecular Weight | 354.19 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | 3-bromo-N-[1-(2,5-difluorophenyl)ethyl]-5-methylbenzamide |
| SMILES | Cc1cc(Br)cc(C(=O)NC(C)c2cc(F)ccc2F)c1 |
| InChI | InChI=1S/C16H14BrF2NO/c1-9-5-11(7-12(17)6-9)16(21)20-10(2)14-8-13(18)3-4-15(14)19/h3-8,10H,1-2H3,(H,20,21) |
| InChIKey | HQMDAADSBFPPGO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.19 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |