C12H17NO5 — CID 46536432
N-ethoxy-2,4,5-trimethoxybenzamide (PubChem CID 46536432) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is N-ethoxy-2,4,5-trimethoxybenzamide.
| Compound Name | N-ethoxy-2,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 46536432 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | N-ethoxy-2,4,5-trimethoxybenzamide |
| SMILES | CCONC(=O)c1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C12H17NO5/c1-5-18-13-12(14)8-6-10(16-3)11(17-4)7-9(8)15-2/h6-7H,5H2,1-4H3,(H,13,14) |
| InChIKey | JOVRXXIROQAACC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|