C12H17NO4 — CID 52555843
N-ethoxy-3,5-dimethoxy-4-methylbenzamide (PubChem CID 52555843) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is N-ethoxy-3,5-dimethoxy-4-methylbenzamide.
| Compound Name | N-ethoxy-3,5-dimethoxy-4-methylbenzamide |
|---|---|
| PubChem CID | 52555843 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | N-ethoxy-3,5-dimethoxy-4-methylbenzamide |
| SMILES | CCONC(=O)c1cc(OC)c(C)c(OC)c1 |
| InChI | InChI=1S/C12H17NO4/c1-5-17-13-12(14)9-6-10(15-3)8(2)11(7-9)16-4/h6-7H,5H2,1-4H3,(H,13,14) |
| InChIKey | IVRNMHYFFXOPNQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|