C23H13F6O4- — CID 164747299
5-(2,6-diphenylphenoxy)-2,2,3,3,4,4-hexafluoro-5-oxopentanoate (PubChem CID 164747299) has the molecular formula C23H13F6O4- and a molecular weight of 467.34 g/mol. Its IUPAC name is 5-(2,6-diphenylphenoxy)-2,2,3,3,4,4-hexafluoro-5-oxopentanoate.
| Compound Name | 5-(2,6-diphenylphenoxy)-2,2,3,3,4,4-hexafluoro-5-oxopentanoate |
|---|---|
| PubChem CID | 164747299 |
| Molecular Formula | C23H13F6O4- |
| Molecular Weight | 467.34 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | 5-(2,6-diphenylphenoxy)-2,2,3,3,4,4-hexafluoro-5-oxopentanoate |
| SMILES | O=C([O-])C(F)(F)C(F)(F)C(F)(F)C(=O)Oc1c(-c2ccccc2)cccc1-c1ccccc1 |
| InChI | InChI=1S/C23H14F6O4/c24-21(25,19(30)31)23(28,29)22(26,27)20(32)33-18-16(14-8-3-1-4-9-14)12-7-13-17(18)15-10-5-2-6-11-15/h1-13H,(H,30,31)/p-1 |
| InChIKey | MQUIBZXMAQBZOF-UHFFFAOYSA-M |
| XLogP | 4.58 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.34 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|