C38H27NO4 — CID 10053564
(2,6-diphenylphenyl) N-(2,6-diphenylphenoxy)carbonylcarbamate (PubChem CID 10053564) has the molecular formula C38H27NO4 and a molecular weight of 561.64 g/mol. Its IUPAC name is (2,6-diphenylphenyl) N-(2,6-diphenylphenoxy)carbonylcarbamate.
| Compound Name | (2,6-diphenylphenyl) N-(2,6-diphenylphenoxy)carbonylcarbamate |
|---|---|
| PubChem CID | 10053564 |
| Molecular Formula | C38H27NO4 |
| Molecular Weight | 561.64 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | (2,6-diphenylphenyl) N-(2,6-diphenylphenoxy)carbonylcarbamate |
| SMILES | O=C(NC(=O)Oc1c(-c2ccccc2)cccc1-c1ccccc1)Oc1c(-c2ccccc2)cccc1-c1ccccc1 |
| InChI | InChI=1S/C38H27NO4/c40-37(42-35-31(27-15-5-1-6-16-27)23-13-24-32(35)28-17-7-2-8-18-28)39-38(41)43-36-33(29-19-9-3-10-20-29)25-14-26-34(36)30-21-11-4-12-22-30/h1-26H,(H,39,40,41) |
| InChIKey | JIBNAKNPXHCTBI-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.64 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |