C22H32O4 — CID 139685051
(2,6-ditert-butylphenyl) 5,5-dimethoxy-4-methylpent-2-ynoate (PubChem CID 139685051) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is (2,6-ditert-butylphenyl) 5,5-dimethoxy-4-methylpent-2-ynoate.
| Compound Name | (2,6-ditert-butylphenyl) 5,5-dimethoxy-4-methylpent-2-ynoate |
|---|---|
| PubChem CID | 139685051 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (2,6-ditert-butylphenyl) 5,5-dimethoxy-4-methylpent-2-ynoate |
| SMILES | COC(OC)C(C)C#CC(=O)Oc1c(C(C)(C)C)cccc1C(C)(C)C |
| InChI | InChI=1S/C22H32O4/c1-15(20(24-8)25-9)13-14-18(23)26-19-16(21(2,3)4)11-10-12-17(19)22(5,6)7/h10-12,15,20H,1-9H3 |
| InChIKey | DWWHSHNTKNLWGB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|