C13H8F3NO4 — CID 22730740
methyl 8-(2,2,2-trifluoroacetyl)oxyquinoline-2-carboxylate (PubChem CID 22730740) has the molecular formula C13H8F3NO4 and a molecular weight of 299.20 g/mol. Its IUPAC name is methyl 8-(2,2,2-trifluoroacetyl)oxyquinoline-2-carboxylate.
| Compound Name | methyl 8-(2,2,2-trifluoroacetyl)oxyquinoline-2-carboxylate |
|---|---|
| PubChem CID | 22730740 |
| Molecular Formula | C13H8F3NO4 |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | methyl 8-(2,2,2-trifluoroacetyl)oxyquinoline-2-carboxylate |
| SMILES | COC(=O)c1ccc2cccc(OC(=O)C(F)(F)F)c2n1 |
| InChI | InChI=1S/C13H8F3NO4/c1-20-11(18)8-6-5-7-3-2-4-9(10(7)17-8)21-12(19)13(14,15)16/h2-6H,1H3 |
| InChIKey | XWNQBYCHOCRRCC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|