methyl 8-fluoroquinoline-2-carboxylate;2,2,2-trifluoroacetic acid

C13H9F4NO4 — CID 175906706

IUPACmethyl 8-fluoroquinoline-2-carboxylate;2,2,2-trifluoroacetic acid
SMILESCOC(=O)c1ccc2cccc(F)c2n1.O=C(O)C(F)(F)F
InChIInChI=1S/C11H8FNO2.C2HF3O2/c1-15-11(14)9-6-5-7-3-2-4-8(12)10(7)13-9;3-2(4,5)1(6)7/h2-6H,1H3;(H,6,7)
InChIKeyXRAUJLDQQVDZTN-UHFFFAOYSA-N
MW319.21 g/mol
LogP2.79
Rot. Bonds1

About methyl 8-fluoroquinoline-2-carboxylate;2,2,2-trifluoroacetic acid

methyl 8-fluoroquinoline-2-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 175906706) has the molecular formula C13H9F4NO4 and a molecular weight of 319.21 g/mol. Its IUPAC name is methyl 8-fluoroquinoline-2-carboxylate;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Namemethyl 8-fluoroquinoline-2-carboxylate;2,2,2-trifluoroacetic acid
PubChem CID175906706
Molecular FormulaC13H9F4NO4
Molecular Weight319.21 g/mol
Exact Mass319.05
IUPAC Namemethyl 8-fluoroquinoline-2-carboxylate;2,2,2-trifluoroacetic acid
SMILESCOC(=O)c1ccc2cccc(F)c2n1.O=C(O)C(F)(F)F
InChIInChI=1S/C11H8FNO2.C2HF3O2/c1-15-11(14)9-6-5-7-3-2-4-8(12)10(7)13-9;3-2(4,5)1(6)7/h2-6H,1H3;(H,6,7)
InChIKeyXRAUJLDQQVDZTN-UHFFFAOYSA-N
XLogP2.79
TPSA76.49 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500319.21
LogP ≤ 52.79
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 8-fluoroquinoline-2-carboxylate;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 8-fluoroquinoline-2-carboxylate;2,2,2-trifluoroacetic acid?
The IUPAC name of methyl 8-fluoroquinoline-2-carboxylate;2,2,2-trifluoroacetic acid (CID 175906706) is methyl 8-fluoroquinoline-2-carboxylate;2,2,2-trifluoroacetic acid.
What is the SMILES notation for methyl 8-fluoroquinoline-2-carboxylate;2,2,2-trifluoroacetic acid?
The canonical SMILES for methyl 8-fluoroquinoline-2-carboxylate;2,2,2-trifluoroacetic acid is COC(=O)c1ccc2cccc(F)c2n1.O=C(O)C(F)(F)F.
What is the InChIKey of methyl 8-fluoroquinoline-2-carboxylate;2,2,2-trifluoroacetic acid?
The InChIKey is XRAUJLDQQVDZTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8FNO2.C2HF3O2/c1-15-11(14)9-6-5-7-3-2-4-8(12)10(7)13-9;3-2(4,5)1(6)7/h2-6H,1H3;(H,6,7).
What are the key properties of methyl 8-fluoroquinoline-2-carboxylate;2,2,2-trifluoroacetic acid?
methyl 8-fluoroquinoline-2-carboxylate;2,2,2-trifluoroacetic acid has a molecular weight of 319.21 g/mol, XLogP of 2.79, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-fluoroquinoline-2-carboxylate;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 175906706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).