C9H8F3NO2S — CID 139688338
(3-amino-2-methylsulfanylphenyl) 2,2,2-trifluoroacetate (PubChem CID 139688338) has the molecular formula C9H8F3NO2S and a molecular weight of 251.23 g/mol. Its IUPAC name is (3-amino-2-methylsulfanylphenyl) 2,2,2-trifluoroacetate.
| Compound Name | (3-amino-2-methylsulfanylphenyl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 139688338 |
| Molecular Formula | C9H8F3NO2S |
| Molecular Weight | 251.23 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | (3-amino-2-methylsulfanylphenyl) 2,2,2-trifluoroacetate |
| SMILES | CSc1c(N)cccc1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C9H8F3NO2S/c1-16-7-5(13)3-2-4-6(7)15-8(14)9(10,11)12/h2-4H,13H2,1H3 |
| InChIKey | DKGLRWZIEGSENV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.23 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|