C16H12F3NO4 — CID 143233935
[3-carbamoyl-2-(2-methoxyphenyl)phenyl] 2,2,2-trifluoroacetate (PubChem CID 143233935) has the molecular formula C16H12F3NO4 and a molecular weight of 339.27 g/mol. Its IUPAC name is [3-carbamoyl-2-(2-methoxyphenyl)phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [3-carbamoyl-2-(2-methoxyphenyl)phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 143233935 |
| Molecular Formula | C16H12F3NO4 |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | [3-carbamoyl-2-(2-methoxyphenyl)phenyl] 2,2,2-trifluoroacetate |
| SMILES | COc1ccccc1-c1c(OC(=O)C(F)(F)F)cccc1C(N)=O |
| InChI | InChI=1S/C16H12F3NO4/c1-23-11-7-3-2-5-9(11)13-10(14(20)21)6-4-8-12(13)24-15(22)16(17,18)19/h2-8H,1H3,(H2,20,21) |
| InChIKey | UCXJLIHAHXWBGU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|