About (2,5-dihydroxy-1H-pyrrol-3-yl) 2,2,2-trifluoroacetate
(2,5-dihydroxy-1H-pyrrol-3-yl) 2,2,2-trifluoroacetate (PubChem CID 91237543) has the molecular formula C6H4F3NO4
and a molecular weight of 211.09 g/mol. Its IUPAC name is (2,5-dihydroxy-1H-pyrrol-3-yl) 2,2,2-trifluoroacetate.
Analyze (2,5-dihydroxy-1H-pyrrol-3-yl) 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dihydroxy-1H-pyrrol-3-yl) 2,2,2-trifluoroacetate?
The IUPAC name of (2,5-dihydroxy-1H-pyrrol-3-yl) 2,2,2-trifluoroacetate (CID 91237543) is (2,5-dihydroxy-1H-pyrrol-3-yl) 2,2,2-trifluoroacetate.
What is the SMILES notation for (2,5-dihydroxy-1H-pyrrol-3-yl) 2,2,2-trifluoroacetate?
The canonical SMILES for (2,5-dihydroxy-1H-pyrrol-3-yl) 2,2,2-trifluoroacetate is O=C(Oc1cc(O)[nH]c1O)C(F)(F)F.
What is the InChIKey of (2,5-dihydroxy-1H-pyrrol-3-yl) 2,2,2-trifluoroacetate?
The InChIKey is SOVDYYPBFOVSRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F3NO4/c7-6(8,9)5(13)14-2-1-3(11)10-4(2)12/h1,10-12H.
What are the key properties of (2,5-dihydroxy-1H-pyrrol-3-yl) 2,2,2-trifluoroacetate?
(2,5-dihydroxy-1H-pyrrol-3-yl) 2,2,2-trifluoroacetate has a molecular weight of 211.09 g/mol, XLogP of 0.89, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxy-1H-pyrrol-3-yl) 2,2,2-trifluoroacetate is sourced from PubChem (CID 91237543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).