C13H8F3NO2 — CID 102529652
(2-pyridin-2-ylphenyl) 2,2,2-trifluoroacetate (PubChem CID 102529652) has the molecular formula C13H8F3NO2 and a molecular weight of 267.21 g/mol. Its IUPAC name is (2-pyridin-2-ylphenyl) 2,2,2-trifluoroacetate.
| Compound Name | (2-pyridin-2-ylphenyl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 102529652 |
| Molecular Formula | C13H8F3NO2 |
| Molecular Weight | 267.21 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | (2-pyridin-2-ylphenyl) 2,2,2-trifluoroacetate |
| SMILES | O=C(Oc1ccccc1-c1ccccn1)C(F)(F)F |
| InChI | InChI=1S/C13H8F3NO2/c14-13(15,16)12(18)19-11-7-2-1-5-9(11)10-6-3-4-8-17-10/h1-8H |
| InChIKey | PNPHZOXJHBPQSF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.21 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|