C16H7BrF4N2O4 — CID 138542984
[4-(3-bromo-2-fluorophenoxy)-6-hydroxyquinazolin-7-yl] 2,2,2-trifluoroacetate (PubChem CID 138542984) has the molecular formula C16H7BrF4N2O4 and a molecular weight of 447.14 g/mol. Its IUPAC name is [4-(3-bromo-2-fluorophenoxy)-6-hydroxyquinazolin-7-yl] 2,2,2-trifluoroacetate.
| Compound Name | [4-(3-bromo-2-fluorophenoxy)-6-hydroxyquinazolin-7-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 138542984 |
| Molecular Formula | C16H7BrF4N2O4 |
| Molecular Weight | 447.14 g/mol |
| Exact Mass | 445.95 |
| IUPAC Name | [4-(3-bromo-2-fluorophenoxy)-6-hydroxyquinazolin-7-yl] 2,2,2-trifluoroacetate |
| SMILES | O=C(Oc1cc2ncnc(Oc3cccc(Br)c3F)c2cc1O)C(F)(F)F |
| InChI | InChI=1S/C16H7BrF4N2O4/c17-8-2-1-3-11(13(8)18)26-14-7-4-10(24)12(5-9(7)22-6-23-14)27-15(25)16(19,20)21/h1-6,24H |
| InChIKey | RCJFCJAAEOBLLF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.14 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|