About 6-bromo-4-[2-(2,2,2-trifluoroethoxy)phenoxy]quinazoline
6-bromo-4-[2-(2,2,2-trifluoroethoxy)phenoxy]quinazoline (PubChem CID 86946168) has the molecular formula C16H10BrF3N2O2
and a molecular weight of 399.17 g/mol. Its IUPAC name is 6-bromo-4-[2-(2,2,2-trifluoroethoxy)phenoxy]quinazoline.
Molecular Properties
| Compound Name | 6-bromo-4-[2-(2,2,2-trifluoroethoxy)phenoxy]quinazoline |
| PubChem CID | 86946168 |
| Molecular Formula | C16H10BrF3N2O2 |
| Molecular Weight | 399.17 g/mol |
| Exact Mass | 397.99 |
| IUPAC Name | 6-bromo-4-[2-(2,2,2-trifluoroethoxy)phenoxy]quinazoline |
| SMILES | FC(F)(F)COc1ccccc1Oc1ncnc2ccc(Br)cc12 |
| InChI | InChI=1S/C16H10BrF3N2O2/c17-10-5-6-12-11(7-10)15(22-9-21-12)24-14-4-2-1-3-13(14)23-8-16(18,19)20/h1-7,9H,8H2 |
| InChIKey | BIYBHNXJDPLVKV-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.17 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-bromo-4-[2-(2,2,2-trifluoroethoxy)phenoxy]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4-[2-(2,2,2-trifluoroethoxy)phenoxy]quinazoline?
The IUPAC name of 6-bromo-4-[2-(2,2,2-trifluoroethoxy)phenoxy]quinazoline (CID 86946168) is 6-bromo-4-[2-(2,2,2-trifluoroethoxy)phenoxy]quinazoline.
What is the SMILES notation for 6-bromo-4-[2-(2,2,2-trifluoroethoxy)phenoxy]quinazoline?
The canonical SMILES for 6-bromo-4-[2-(2,2,2-trifluoroethoxy)phenoxy]quinazoline is FC(F)(F)COc1ccccc1Oc1ncnc2ccc(Br)cc12.
What is the InChIKey of 6-bromo-4-[2-(2,2,2-trifluoroethoxy)phenoxy]quinazoline?
The InChIKey is BIYBHNXJDPLVKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10BrF3N2O2/c17-10-5-6-12-11(7-10)15(22-9-21-12)24-14-4-2-1-3-13(14)23-8-16(18,19)20/h1-7,9H,8H2.
What are the key properties of 6-bromo-4-[2-(2,2,2-trifluoroethoxy)phenoxy]quinazoline?
6-bromo-4-[2-(2,2,2-trifluoroethoxy)phenoxy]quinazoline has a molecular weight of 399.17 g/mol, XLogP of 5.13, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4-[2-(2,2,2-trifluoroethoxy)phenoxy]quinazoline is sourced from PubChem (CID 86946168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).