C9H4F3NO5S — CID 54372980
(1,1,3-trioxo-1,2-benzothiazol-4-yl) 2,2,2-trifluoroacetate (PubChem CID 54372980) has the molecular formula C9H4F3NO5S and a molecular weight of 295.19 g/mol. Its IUPAC name is (1,1,3-trioxo-1,2-benzothiazol-4-yl) 2,2,2-trifluoroacetate.
| Compound Name | (1,1,3-trioxo-1,2-benzothiazol-4-yl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 54372980 |
| Molecular Formula | C9H4F3NO5S |
| Molecular Weight | 295.19 g/mol |
| Exact Mass | 294.98 |
| IUPAC Name | (1,1,3-trioxo-1,2-benzothiazol-4-yl) 2,2,2-trifluoroacetate |
| SMILES | O=C1NS(=O)(=O)c2cccc(OC(=O)C(F)(F)F)c21 |
| InChI | InChI=1S/C9H4F3NO5S/c10-9(11,12)8(15)18-4-2-1-3-5-6(4)7(14)13-19(5,16)17/h1-3H,(H,13,14) |
| InChIKey | UUNFMHLJTMKUSD-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.19 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|