C9H9NO4S — CID 14984045
4-ethoxy-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 14984045) has the molecular formula C9H9NO4S and a molecular weight of 227.24 g/mol. Its IUPAC name is 4-ethoxy-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 4-ethoxy-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 14984045 |
| Molecular Formula | C9H9NO4S |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 4-ethoxy-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | CCOc1cccc2c1C(=O)NS2(=O)=O |
| InChI | InChI=1S/C9H9NO4S/c1-2-14-6-4-3-5-7-8(6)9(11)10-15(7,12)13/h3-5H,2H2,1H3,(H,10,11) |
| InChIKey | MDCZVIPWZYFOTA-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |