C10H11NO3S — CID 11770128
1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one (PubChem CID 11770128) has the molecular formula C10H11NO3S and a molecular weight of 225.27 g/mol. Its IUPAC name is 1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one.
| Compound Name | 1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 11770128 |
| Molecular Formula | C10H11NO3S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | 1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one |
| SMILES | CC(C)c1cccc2c1C(=O)NS2(=O)=O |
| InChI | InChI=1S/C10H11NO3S/c1-6(2)7-4-3-5-8-9(7)10(12)11-15(8,13)14/h3-6H,1-2H3,(H,11,12) |
| InChIKey | MRPAHFZTHXMLRO-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |