C12H15NO4S — CID 70033335
6-ethoxy-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one (PubChem CID 70033335) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is 6-ethoxy-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one.
| Compound Name | 6-ethoxy-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 70033335 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 6-ethoxy-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one |
| SMILES | CCOc1cc(C(C)C)c2c(c1)S(=O)(=O)NC2=O |
| InChI | InChI=1S/C12H15NO4S/c1-4-17-8-5-9(7(2)3)11-10(6-8)18(15,16)13-12(11)14/h5-7H,4H2,1-3H3,(H,13,14) |
| InChIKey | YLBPNSBKFLYJJG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |