C15H24N2O5S — CID 172731477
4,6-diethoxy-1,1-dioxo-1,2-benzothiazol-3-one;N-ethylethanamine (PubChem CID 172731477) has the molecular formula C15H24N2O5S and a molecular weight of 344.43 g/mol. Its IUPAC name is 4,6-diethoxy-1,1-dioxo-1,2-benzothiazol-3-one;N-ethylethanamine.
| Compound Name | 4,6-diethoxy-1,1-dioxo-1,2-benzothiazol-3-one;N-ethylethanamine |
|---|---|
| PubChem CID | 172731477 |
| Molecular Formula | C15H24N2O5S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 4,6-diethoxy-1,1-dioxo-1,2-benzothiazol-3-one;N-ethylethanamine |
| SMILES | CCNCC.CCOc1cc(OCC)c2c(c1)S(=O)(=O)NC2=O |
| InChI | InChI=1S/C11H13NO5S.C4H11N/c1-3-16-7-5-8(17-4-2)10-9(6-7)18(14,15)12-11(10)13;1-3-5-4-2/h5-6H,3-4H2,1-2H3,(H,12,13);5H,3-4H2,1-2H3 |
| InChIKey | HVUSCKPLXJUOON-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |