C19H23ClN2O5S — CID 67825210
2-(chloromethyl)-6-[[5-[(dimethylamino)methyl]furan-2-yl]methoxy]-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one (PubChem CID 67825210) has the molecular formula C19H23ClN2O5S and a molecular weight of 426.92 g/mol. Its IUPAC name is 2-(chloromethyl)-6-[[5-[(dimethylamino)methyl]furan-2-yl]methoxy]-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one.
| Compound Name | 2-(chloromethyl)-6-[[5-[(dimethylamino)methyl]furan-2-yl]methoxy]-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 67825210 |
| Molecular Formula | C19H23ClN2O5S |
| Molecular Weight | 426.92 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 2-(chloromethyl)-6-[[5-[(dimethylamino)methyl]furan-2-yl]methoxy]-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one |
| SMILES | CC(C)c1cc(OCc2ccc(CN(C)C)o2)cc2c1C(=O)N(CCl)S2(=O)=O |
| InChI | InChI=1S/C19H23ClN2O5S/c1-12(2)16-7-15(26-10-14-6-5-13(27-14)9-21(3)4)8-17-18(16)19(23)22(11-20)28(17,24)25/h5-8,12H,9-11H2,1-4H3 |
| InChIKey | XKOWCBVJZSHIHS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.92 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|