About [5-[(dimethylamino)methyl]furan-2-yl]methyl 2-aminoethanesulfonate
[5-[(dimethylamino)methyl]furan-2-yl]methyl 2-aminoethanesulfonate (PubChem CID 154400451) has the molecular formula C10H18N2O4S
and a molecular weight of 262.33 g/mol. Its IUPAC name is [5-[(dimethylamino)methyl]furan-2-yl]methyl 2-aminoethanesulfonate.
Molecular Properties
| Compound Name | [5-[(dimethylamino)methyl]furan-2-yl]methyl 2-aminoethanesulfonate |
| PubChem CID | 154400451 |
| Molecular Formula | C10H18N2O4S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | [5-[(dimethylamino)methyl]furan-2-yl]methyl 2-aminoethanesulfonate |
| SMILES | CN(C)Cc1ccc(COS(=O)(=O)CCN)o1 |
| InChI | InChI=1S/C10H18N2O4S/c1-12(2)7-9-3-4-10(16-9)8-15-17(13,14)6-5-11/h3-4H,5-8,11H2,1-2H3 |
| InChIKey | PZKMJKFIHSTMCH-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [5-[(dimethylamino)methyl]furan-2-yl]methyl 2-aminoethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(dimethylamino)methyl]furan-2-yl]methyl 2-aminoethanesulfonate?
The IUPAC name of [5-[(dimethylamino)methyl]furan-2-yl]methyl 2-aminoethanesulfonate (CID 154400451) is [5-[(dimethylamino)methyl]furan-2-yl]methyl 2-aminoethanesulfonate.
What is the SMILES notation for [5-[(dimethylamino)methyl]furan-2-yl]methyl 2-aminoethanesulfonate?
The canonical SMILES for [5-[(dimethylamino)methyl]furan-2-yl]methyl 2-aminoethanesulfonate is CN(C)Cc1ccc(COS(=O)(=O)CCN)o1.
What is the InChIKey of [5-[(dimethylamino)methyl]furan-2-yl]methyl 2-aminoethanesulfonate?
The InChIKey is PZKMJKFIHSTMCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O4S/c1-12(2)7-9-3-4-10(16-9)8-15-17(13,14)6-5-11/h3-4H,5-8,11H2,1-2H3.
What are the key properties of [5-[(dimethylamino)methyl]furan-2-yl]methyl 2-aminoethanesulfonate?
[5-[(dimethylamino)methyl]furan-2-yl]methyl 2-aminoethanesulfonate has a molecular weight of 262.33 g/mol, XLogP of 0.15, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(dimethylamino)methyl]furan-2-yl]methyl 2-aminoethanesulfonate is sourced from PubChem (CID 154400451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).