C8H13NO3S — CID 52524091
N-methyl-N-[(5-methylfuran-2-yl)methyl]methanesulfonamide (PubChem CID 52524091) has the molecular formula C8H13NO3S and a molecular weight of 203.26 g/mol. Its IUPAC name is N-methyl-N-[(5-methylfuran-2-yl)methyl]methanesulfonamide.
| Compound Name | N-methyl-N-[(5-methylfuran-2-yl)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 52524091 |
| Molecular Formula | C8H13NO3S |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | N-methyl-N-[(5-methylfuran-2-yl)methyl]methanesulfonamide |
| SMILES | Cc1ccc(CN(C)S(C)(=O)=O)o1 |
| InChI | InChI=1S/C8H13NO3S/c1-7-4-5-8(12-7)6-9(2)13(3,10)11/h4-5H,6H2,1-3H3 |
| InChIKey | VJGSKPAFIYLVGV-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |