C14H18N2O3S — CID 43526071
3-amino-N,2-dimethyl-N-[(5-methylfuran-2-yl)methyl]benzenesulfonamide (PubChem CID 43526071) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is 3-amino-N,2-dimethyl-N-[(5-methylfuran-2-yl)methyl]benzenesulfonamide.
| Compound Name | 3-amino-N,2-dimethyl-N-[(5-methylfuran-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 43526071 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 3-amino-N,2-dimethyl-N-[(5-methylfuran-2-yl)methyl]benzenesulfonamide |
| SMILES | Cc1ccc(CN(C)S(=O)(=O)c2cccc(N)c2C)o1 |
| InChI | InChI=1S/C14H18N2O3S/c1-10-7-8-12(19-10)9-16(3)20(17,18)14-6-4-5-13(15)11(14)2/h4-8H,9,15H2,1-3H3 |
| InChIKey | YEVIYYUBJNAUHK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|