C10H19N3O3S — CID 112686122
2-[[2-(dimethylamino)ethyl-sulfamoylamino]methyl]-5-methylfuran (PubChem CID 112686122) has the molecular formula C10H19N3O3S and a molecular weight of 261.35 g/mol. Its IUPAC name is 2-[[2-(dimethylamino)ethyl-sulfamoylamino]methyl]-5-methylfuran.
| Compound Name | 2-[[2-(dimethylamino)ethyl-sulfamoylamino]methyl]-5-methylfuran |
|---|---|
| PubChem CID | 112686122 |
| Molecular Formula | C10H19N3O3S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 2-[[2-(dimethylamino)ethyl-sulfamoylamino]methyl]-5-methylfuran |
| SMILES | Cc1ccc(CN(CCN(C)C)S(N)(=O)=O)o1 |
| InChI | InChI=1S/C10H19N3O3S/c1-9-4-5-10(16-9)8-13(17(11,14)15)7-6-12(2)3/h4-5H,6-8H2,1-3H3,(H2,11,14,15) |
| InChIKey | LGCIXOCDHSBITK-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |