C13H23ClN2O3S — CID 60959199
3-chloro-N-[2-(dimethylamino)ethyl]-N-[(5-methylfuran-2-yl)methyl]propane-1-sulfonamide (PubChem CID 60959199) has the molecular formula C13H23ClN2O3S and a molecular weight of 322.86 g/mol. Its IUPAC name is 3-chloro-N-[2-(dimethylamino)ethyl]-N-[(5-methylfuran-2-yl)methyl]propane-1-sulfonamide.
| Compound Name | 3-chloro-N-[2-(dimethylamino)ethyl]-N-[(5-methylfuran-2-yl)methyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 60959199 |
| Molecular Formula | C13H23ClN2O3S |
| Molecular Weight | 322.86 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 3-chloro-N-[2-(dimethylamino)ethyl]-N-[(5-methylfuran-2-yl)methyl]propane-1-sulfonamide |
| SMILES | Cc1ccc(CN(CCN(C)C)S(=O)(=O)CCCCl)o1 |
| InChI | InChI=1S/C13H23ClN2O3S/c1-12-5-6-13(19-12)11-16(9-8-15(2)3)20(17,18)10-4-7-14/h5-6H,4,7-11H2,1-3H3 |
| InChIKey | MSWLFJXAHQOVCO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.86 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|