C8H13Cl2NO2 — CID 160653099
1-[5-(chloromethyl)furan-2-yl]-N,N-dimethylmethanamine;hypochlorous acid (PubChem CID 160653099) has the molecular formula C8H13Cl2NO2 and a molecular weight of 226.10 g/mol. Its IUPAC name is 1-[5-(chloromethyl)furan-2-yl]-N,N-dimethylmethanamine;hypochlorous acid.
| Compound Name | 1-[5-(chloromethyl)furan-2-yl]-N,N-dimethylmethanamine;hypochlorous acid |
|---|---|
| PubChem CID | 160653099 |
| Molecular Formula | C8H13Cl2NO2 |
| Molecular Weight | 226.10 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | 1-[5-(chloromethyl)furan-2-yl]-N,N-dimethylmethanamine;hypochlorous acid |
| SMILES | CN(C)Cc1ccc(CCl)o1.OCl |
| InChI | InChI=1S/C8H12ClNO.ClHO/c1-10(2)6-8-4-3-7(5-9)11-8;1-2/h3-4H,5-6H2,1-2H3;2H |
| InChIKey | RKRGNVCSEWMJOD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.10 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|