C15H25LiN2O3 — CID 160568375
lithium;1-[[5-[(dimethylamino)methyl]furan-2-yl]methyl]piperidine-4-carboxylate;methane (PubChem CID 160568375) has the molecular formula C15H25LiN2O3 and a molecular weight of 288.32 g/mol. Its IUPAC name is lithium;1-[[5-[(dimethylamino)methyl]furan-2-yl]methyl]piperidine-4-carboxylate;methane.
| Compound Name | lithium;1-[[5-[(dimethylamino)methyl]furan-2-yl]methyl]piperidine-4-carboxylate;methane |
|---|---|
| PubChem CID | 160568375 |
| Molecular Formula | C15H25LiN2O3 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | lithium;1-[[5-[(dimethylamino)methyl]furan-2-yl]methyl]piperidine-4-carboxylate;methane |
| SMILES | C.CN(C)Cc1ccc(CN2CCC(C(=O)[O-])CC2)o1.[Li+] |
| InChI | InChI=1S/C14H22N2O3.CH4.Li/c1-15(2)9-12-3-4-13(19-12)10-16-7-5-11(6-8-16)14(17)18;;/h3-4,11H,5-10H2,1-2H3,(H,17,18);1H4;/q;;+1/p-1 |
| InChIKey | RAFLVPZKPRVLOC-UHFFFAOYSA-M |
| XLogP | -2.06 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |