About lithium;1-[[5-[(dimethylamino)methyl]furan-2-yl]methyl]piperidine-4-carboxylate;methane
lithium;1-[[5-[(dimethylamino)methyl]furan-2-yl]methyl]piperidine-4-carboxylate;methane (PubChem CID 160568375) has the molecular formula C15H25LiN2O3
and a molecular weight of 288.32 g/mol. Its IUPAC name is lithium;1-[[5-[(dimethylamino)methyl]furan-2-yl]methyl]piperidine-4-carboxylate;methane.
Molecular Properties
| Compound Name | lithium;1-[[5-[(dimethylamino)methyl]furan-2-yl]methyl]piperidine-4-carboxylate;methane |
| PubChem CID | 160568375 |
| Molecular Formula | C15H25LiN2O3 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | lithium;1-[[5-[(dimethylamino)methyl]furan-2-yl]methyl]piperidine-4-carboxylate;methane |
| SMILES | C.CN(C)Cc1ccc(CN2CCC(C(=O)[O-])CC2)o1.[Li+] |
| InChI | InChI=1S/C14H22N2O3.CH4.Li/c1-15(2)9-12-3-4-13(19-12)10-16-7-5-11(6-8-16)14(17)18;;/h3-4,11H,5-10H2,1-2H3,(H,17,18);1H4;/q;;+1/p-1 |
| InChIKey | RAFLVPZKPRVLOC-UHFFFAOYSA-M |
| XLogP | -2.06 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze lithium;1-[[5-[(dimethylamino)methyl]furan-2-yl]methyl]piperidine-4-carboxylate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;1-[[5-[(dimethylamino)methyl]furan-2-yl]methyl]piperidine-4-carboxylate;methane?
The IUPAC name of lithium;1-[[5-[(dimethylamino)methyl]furan-2-yl]methyl]piperidine-4-carboxylate;methane (CID 160568375) is lithium;1-[[5-[(dimethylamino)methyl]furan-2-yl]methyl]piperidine-4-carboxylate;methane.
What is the SMILES notation for lithium;1-[[5-[(dimethylamino)methyl]furan-2-yl]methyl]piperidine-4-carboxylate;methane?
The canonical SMILES for lithium;1-[[5-[(dimethylamino)methyl]furan-2-yl]methyl]piperidine-4-carboxylate;methane is C.CN(C)Cc1ccc(CN2CCC(C(=O)[O-])CC2)o1.[Li+].
What is the InChIKey of lithium;1-[[5-[(dimethylamino)methyl]furan-2-yl]methyl]piperidine-4-carboxylate;methane?
The InChIKey is RAFLVPZKPRVLOC-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H22N2O3.CH4.Li/c1-15(2)9-12-3-4-13(19-12)10-16-7-5-11(6-8-16)14(17)18;;/h3-4,11H,5-10H2,1-2H3,(H,17,18);1H4;/q;;+1/p-1.
What are the key properties of lithium;1-[[5-[(dimethylamino)methyl]furan-2-yl]methyl]piperidine-4-carboxylate;methane?
lithium;1-[[5-[(dimethylamino)methyl]furan-2-yl]methyl]piperidine-4-carboxylate;methane has a molecular weight of 288.32 g/mol, XLogP of -2.06, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;1-[[5-[(dimethylamino)methyl]furan-2-yl]methyl]piperidine-4-carboxylate;methane is sourced from PubChem (CID 160568375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).