C25H32ClIN4O2 — CID 89242456
[4-(4-chlorobenzenecarboximidoyl)piperidin-1-yl]-[1-[[5-[[iodo(methyl)amino]methyl]furan-2-yl]methyl]piperidin-4-yl]methanone (PubChem CID 89242456) has the molecular formula C25H32ClIN4O2 and a molecular weight of 582.91 g/mol. Its IUPAC name is [4-(4-chlorobenzenecarboximidoyl)piperidin-1-yl]-[1-[[5-[[iodo(methyl)amino]methyl]furan-2-yl]methyl]piperidin-4-yl]methanone.
| Compound Name | [4-(4-chlorobenzenecarboximidoyl)piperidin-1-yl]-[1-[[5-[[iodo(methyl)amino]methyl]furan-2-yl]methyl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 89242456 |
| Molecular Formula | C25H32ClIN4O2 |
| Molecular Weight | 582.91 g/mol |
| Exact Mass | 582.13 |
| IUPAC Name | [4-(4-chlorobenzenecarboximidoyl)piperidin-1-yl]-[1-[[5-[[iodo(methyl)amino]methyl]furan-2-yl]methyl]piperidin-4-yl]methanone |
| SMILES | [H]/N=C(\c1ccc(Cl)cc1)C1CCN(C(=O)C2CCN(Cc3ccc(CN(C)I)o3)CC2)CC1 |
| InChI | InChI=1S/C25H32ClIN4O2/c1-29(27)16-22-6-7-23(33-22)17-30-12-8-20(9-13-30)25(32)31-14-10-19(11-15-31)24(28)18-2-4-21(26)5-3-18/h2-7,19-20,28H,8-17H2,1H3/b28-24+ |
| InChIKey | FDPMLWBXMHPONC-ZZIIXHQDSA-N |
| XLogP | 5.23 |
| TPSA | 63.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.91 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|