C25H30N8O — CID 89080320
[1-[(2-aminopyrimidin-5-yl)methyl]piperidin-4-yl]-[4-(quinoxaline-2-carboximidoyl)piperidin-1-yl]methanone (PubChem CID 89080320) has the molecular formula C25H30N8O and a molecular weight of 458.57 g/mol. Its IUPAC name is [1-[(2-aminopyrimidin-5-yl)methyl]piperidin-4-yl]-[4-(quinoxaline-2-carboximidoyl)piperidin-1-yl]methanone.
| Compound Name | [1-[(2-aminopyrimidin-5-yl)methyl]piperidin-4-yl]-[4-(quinoxaline-2-carboximidoyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 89080320 |
| Molecular Formula | C25H30N8O |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | [1-[(2-aminopyrimidin-5-yl)methyl]piperidin-4-yl]-[4-(quinoxaline-2-carboximidoyl)piperidin-1-yl]methanone |
| SMILES | [H]/N=C(/c1cnc2ccccc2n1)C1CCN(C(=O)C2CCN(Cc3cnc(N)nc3)CC2)CC1 |
| InChI | InChI=1S/C25H30N8O/c26-23(22-15-28-20-3-1-2-4-21(20)31-22)18-7-11-33(12-8-18)24(34)19-5-9-32(10-6-19)16-17-13-29-25(27)30-14-17/h1-4,13-15,18-19,26H,5-12,16H2,(H2,27,29,30)/b26-23+ |
| InChIKey | GHLDFLOPTWBGNY-WNAAXNPUSA-N |
| XLogP | 2.52 |
| TPSA | 124.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|