C25H32N6O2 — CID 123886369
[1-[(2-aminopyrimidin-5-yl)methyl]piperidin-4-yl]-[3-(methoxyamino)spiro[indene-1,4'-piperidine]-1'-yl]methanone (PubChem CID 123886369) has the molecular formula C25H32N6O2 and a molecular weight of 448.57 g/mol. Its IUPAC name is [1-[(2-aminopyrimidin-5-yl)methyl]piperidin-4-yl]-[3-(methoxyamino)spiro[indene-1,4'-piperidine]-1'-yl]methanone.
| Compound Name | [1-[(2-aminopyrimidin-5-yl)methyl]piperidin-4-yl]-[3-(methoxyamino)spiro[indene-1,4'-piperidine]-1'-yl]methanone |
|---|---|
| PubChem CID | 123886369 |
| Molecular Formula | C25H32N6O2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | [1-[(2-aminopyrimidin-5-yl)methyl]piperidin-4-yl]-[3-(methoxyamino)spiro[indene-1,4'-piperidine]-1'-yl]methanone |
| SMILES | CONC1=CC2(CCN(C(=O)C3CCN(Cc4cnc(N)nc4)CC3)CC2)c2ccccc21 |
| InChI | InChI=1S/C25H32N6O2/c1-33-29-22-14-25(21-5-3-2-4-20(21)22)8-12-31(13-9-25)23(32)19-6-10-30(11-7-19)17-18-15-27-24(26)28-16-18/h2-5,14-16,19,29H,6-13,17H2,1H3,(H2,26,27,28) |
| InChIKey | PXWYJBTXDRXKIF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|