C22H29N7O2 — CID 89080147
6-[1-[1-[(2-aminopyrimidin-5-yl)methyl]piperidine-4-carbonyl]piperidine-4-carboximidoyl]-1H-pyridin-2-one (PubChem CID 89080147) has the molecular formula C22H29N7O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 6-[1-[1-[(2-aminopyrimidin-5-yl)methyl]piperidine-4-carbonyl]piperidine-4-carboximidoyl]-1H-pyridin-2-one.
| Compound Name | 6-[1-[1-[(2-aminopyrimidin-5-yl)methyl]piperidine-4-carbonyl]piperidine-4-carboximidoyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 89080147 |
| Molecular Formula | C22H29N7O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 6-[1-[1-[(2-aminopyrimidin-5-yl)methyl]piperidine-4-carbonyl]piperidine-4-carboximidoyl]-1H-pyridin-2-one |
| SMILES | [H]/N=C(/c1cccc(=O)[nH]1)C1CCN(C(=O)C2CCN(Cc3cnc(N)nc3)CC2)CC1 |
| InChI | InChI=1S/C22H29N7O2/c23-20(18-2-1-3-19(30)27-18)16-6-10-29(11-7-16)21(31)17-4-8-28(9-5-17)14-15-12-25-22(24)26-13-15/h1-3,12-13,16-17,23H,4-11,14H2,(H,27,30)(H2,24,25,26)/b23-20+ |
| InChIKey | VQDXAQCZZAVRLG-BSYVCWPDSA-N |
| XLogP | 1.27 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|