About 6-(2-methylpropanoyl)-1,1-dioxo-1,2-benzothiazol-3-one
6-(2-methylpropanoyl)-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 137413322) has the molecular formula C11H11NO4S
and a molecular weight of 253.28 g/mol. Its IUPAC name is 6-(2-methylpropanoyl)-1,1-dioxo-1,2-benzothiazol-3-one.
Molecular Properties
| Compound Name | 6-(2-methylpropanoyl)-1,1-dioxo-1,2-benzothiazol-3-one |
| PubChem CID | 137413322 |
| Molecular Formula | C11H11NO4S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 6-(2-methylpropanoyl)-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | CC(C)C(=O)c1ccc2c(c1)S(=O)(=O)NC2=O |
| InChI | InChI=1S/C11H11NO4S/c1-6(2)10(13)7-3-4-8-9(5-7)17(15,16)12-11(8)14/h3-6H,1-2H3,(H,12,14) |
| InChIKey | YWHWEMNRSLAXLI-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(2-methylpropanoyl)-1,1-dioxo-1,2-benzothiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-methylpropanoyl)-1,1-dioxo-1,2-benzothiazol-3-one?
The IUPAC name of 6-(2-methylpropanoyl)-1,1-dioxo-1,2-benzothiazol-3-one (CID 137413322) is 6-(2-methylpropanoyl)-1,1-dioxo-1,2-benzothiazol-3-one.
What is the SMILES notation for 6-(2-methylpropanoyl)-1,1-dioxo-1,2-benzothiazol-3-one?
The canonical SMILES for 6-(2-methylpropanoyl)-1,1-dioxo-1,2-benzothiazol-3-one is CC(C)C(=O)c1ccc2c(c1)S(=O)(=O)NC2=O.
What is the InChIKey of 6-(2-methylpropanoyl)-1,1-dioxo-1,2-benzothiazol-3-one?
The InChIKey is YWHWEMNRSLAXLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO4S/c1-6(2)10(13)7-3-4-8-9(5-7)17(15,16)12-11(8)14/h3-6H,1-2H3,(H,12,14).
What are the key properties of 6-(2-methylpropanoyl)-1,1-dioxo-1,2-benzothiazol-3-one?
6-(2-methylpropanoyl)-1,1-dioxo-1,2-benzothiazol-3-one has a molecular weight of 253.28 g/mol, XLogP of 0.96, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-methylpropanoyl)-1,1-dioxo-1,2-benzothiazol-3-one is sourced from PubChem (CID 137413322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).