C11H8Cl4O3 — CID 19860516
2,2,2-trichloroethyl 2-(2-chloro-2-oxoethyl)benzoate (PubChem CID 19860516) has the molecular formula C11H8Cl4O3 and a molecular weight of 329.99 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 2-(2-chloro-2-oxoethyl)benzoate.
| Compound Name | 2,2,2-trichloroethyl 2-(2-chloro-2-oxoethyl)benzoate |
|---|---|
| PubChem CID | 19860516 |
| Molecular Formula | C11H8Cl4O3 |
| Molecular Weight | 329.99 g/mol |
| Exact Mass | 327.92 |
| IUPAC Name | 2,2,2-trichloroethyl 2-(2-chloro-2-oxoethyl)benzoate |
| SMILES | O=C(Cl)Cc1ccccc1C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H8Cl4O3/c12-9(16)5-7-3-1-2-4-8(7)10(17)18-6-11(13,14)15/h1-4H,5-6H2 |
| InChIKey | AUVIKZYTUXTZID-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.99 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|