C18H25ClN2O4 — CID 90024521
1-O-tert-butyl 4-O-ethyl 4-(2-chloro-4-pyridinyl)piperidine-1,4-dicarboxylate (PubChem CID 90024521) has the molecular formula C18H25ClN2O4 and a molecular weight of 368.86 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-ethyl 4-(2-chloro-4-pyridinyl)piperidine-1,4-dicarboxylate.
| Compound Name | 1-O-tert-butyl 4-O-ethyl 4-(2-chloro-4-pyridinyl)piperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 90024521 |
| Molecular Formula | C18H25ClN2O4 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 1-O-tert-butyl 4-O-ethyl 4-(2-chloro-4-pyridinyl)piperidine-1,4-dicarboxylate |
| SMILES | CCOC(=O)C1(c2ccnc(Cl)c2)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H25ClN2O4/c1-5-24-15(22)18(13-6-9-20-14(19)12-13)7-10-21(11-8-18)16(23)25-17(2,3)4/h6,9,12H,5,7-8,10-11H2,1-4H3 |
| InChIKey | RGECGDYWWQYEAT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|