C15H24N2O2 — CID 144773835
tert-butyl 4-[(1Z)-1-(methylideneamino)buta-1,3-dienyl]piperidine-1-carboxylate (PubChem CID 144773835) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is tert-butyl 4-[(1Z)-1-(methylideneamino)buta-1,3-dienyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(1Z)-1-(methylideneamino)buta-1,3-dienyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 144773835 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | tert-butyl 4-[(1Z)-1-(methylideneamino)buta-1,3-dienyl]piperidine-1-carboxylate |
| SMILES | C=C/C=C(\N=C)C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H24N2O2/c1-6-7-13(16-5)12-8-10-17(11-9-12)14(18)19-15(2,3)4/h6-7,12H,1,5,8-11H2,2-4H3/b13-7- |
| InChIKey | SBBCSCJUTTZLCG-QPEQYQDCSA-N |
| XLogP | 3.40 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|