C11H22BF3N2O2 — CID 102457603
trifluoro-[[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]azaniumyl]methyl]boranuide (PubChem CID 102457603) has the molecular formula C11H22BF3N2O2 and a molecular weight of 282.11 g/mol. Its IUPAC name is trifluoro-[[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]azaniumyl]methyl]boranuide.
| Compound Name | trifluoro-[[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]azaniumyl]methyl]boranuide |
|---|---|
| PubChem CID | 102457603 |
| Molecular Formula | C11H22BF3N2O2 |
| Molecular Weight | 282.11 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | trifluoro-[[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]azaniumyl]methyl]boranuide |
| SMILES | CC(C)(C)OC(=O)N1CCC([NH2+]C[B-](F)(F)F)CC1 |
| InChI | InChI=1S/C11H21BF3N2O2/c1-11(2,3)19-10(18)17-6-4-9(5-7-17)16-8-12(13,14)15/h9,16H,4-8H2,1-3H3/q-1/p+1 |
| InChIKey | GRAQQQARTKYKFH-UHFFFAOYSA-O |
| XLogP | 1.34 |
| TPSA | 46.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.11 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|