C18H27NO4 — CID 174815191
[(3R)-3-(2-ethoxyphenoxy)piperidin-1-yl] 2,2-dimethylpropanoate (PubChem CID 174815191) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is [(3R)-3-(2-ethoxyphenoxy)piperidin-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [(3R)-3-(2-ethoxyphenoxy)piperidin-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174815191 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | [(3R)-3-(2-ethoxyphenoxy)piperidin-1-yl] 2,2-dimethylpropanoate |
| SMILES | CCOc1ccccc1O[C@@H]1CCCN(OC(=O)C(C)(C)C)C1 |
| InChI | InChI=1S/C18H27NO4/c1-5-21-15-10-6-7-11-16(15)22-14-9-8-12-19(13-14)23-17(20)18(2,3)4/h6-7,10-11,14H,5,8-9,12-13H2,1-4H3/t14-/m1/s1 |
| InChIKey | AZJHYJAGRBYSLK-CQSZACIVSA-N |
| XLogP | 3.43 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |